C16H12FNS2 — CID 21408481
2-fluorobicyclo[2.2.0]hexa-1(4),2,5-triene;4-(4-methylphenyl)-3H-1,3-thiazole-2-thione (PubChem CID 21408481) has the molecular formula C16H12FNS2 and a molecular weight of 301.41 g/mol. Its IUPAC name is 2-fluorobicyclo[2.2.0]hexa-1(4),2,5-triene;4-(4-methylphenyl)-3H-1,3-thiazole-2-thione.
| Compound Name | 2-fluorobicyclo[2.2.0]hexa-1(4),2,5-triene;4-(4-methylphenyl)-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 21408481 |
| Molecular Formula | C16H12FNS2 |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 2-fluorobicyclo[2.2.0]hexa-1(4),2,5-triene;4-(4-methylphenyl)-3H-1,3-thiazole-2-thione |
| SMILES | Cc1ccc(-c2csc(=S)[nH]2)cc1.Fc1cc2ccc1=2 |
| InChI | InChI=1S/C10H9NS2.C6H3F/c1-7-2-4-8(5-3-7)9-6-13-10(12)11-9;7-6-3-4-1-2-5(4)6/h2-6H,1H3,(H,11,12);1-3H |
| InChIKey | QELLSYZXVAECSD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|