C21H22N2O6S — CID 21408527
2-[4,5-bis(3,4-dimethoxyphenyl)-1,3-oxazol-2-yl]-2-sulfanylacetamide (PubChem CID 21408527) has the molecular formula C21H22N2O6S and a molecular weight of 430.48 g/mol. Its IUPAC name is 2-[4,5-bis(3,4-dimethoxyphenyl)-1,3-oxazol-2-yl]-2-sulfanylacetamide.
| Compound Name | 2-[4,5-bis(3,4-dimethoxyphenyl)-1,3-oxazol-2-yl]-2-sulfanylacetamide |
|---|---|
| PubChem CID | 21408527 |
| Molecular Formula | C21H22N2O6S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 2-[4,5-bis(3,4-dimethoxyphenyl)-1,3-oxazol-2-yl]-2-sulfanylacetamide |
| SMILES | COc1ccc(-c2nc(C(S)C(N)=O)oc2-c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C21H22N2O6S/c1-25-13-7-5-11(9-15(13)27-3)17-18(29-21(23-17)19(30)20(22)24)12-6-8-14(26-2)16(10-12)28-4/h5-10,19,30H,1-4H3,(H2,22,24) |
| InChIKey | WSLJBMCRIXGIEY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|