C20H18F3NO3S — CID 21408814
4-phenyl-1,3-oxazole;2-sulfanylbutanoic acid;2-(trifluoromethyl)bicyclo[2.2.0]hexa-1,3,5-triene (PubChem CID 21408814) has the molecular formula C20H18F3NO3S and a molecular weight of 409.43 g/mol. Its IUPAC name is 4-phenyl-1,3-oxazole;2-sulfanylbutanoic acid;2-(trifluoromethyl)bicyclo[2.2.0]hexa-1,3,5-triene.
| Compound Name | 4-phenyl-1,3-oxazole;2-sulfanylbutanoic acid;2-(trifluoromethyl)bicyclo[2.2.0]hexa-1,3,5-triene |
|---|---|
| PubChem CID | 21408814 |
| Molecular Formula | C20H18F3NO3S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 4-phenyl-1,3-oxazole;2-sulfanylbutanoic acid;2-(trifluoromethyl)bicyclo[2.2.0]hexa-1,3,5-triene |
| SMILES | CCC(S)C(=O)O.FC(F)(F)c1cc2ccc1-2.c1ccc(-c2cocn2)cc1 |
| InChI | InChI=1S/C9H7NO.C7H3F3.C4H8O2S/c1-2-4-8(5-3-1)9-6-11-7-10-9;8-7(9,10)6-3-4-1-2-5(4)6;1-2-3(7)4(5)6/h1-7H;1-3H;3,7H,2H2,1H3,(H,5,6) |
| InChIKey | WJRXDPITTYNOTN-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|