About 4-(4-chlorophenyl)-5-(4-fluorophenyl)-3H-1,3-oxazole-2-thione
4-(4-chlorophenyl)-5-(4-fluorophenyl)-3H-1,3-oxazole-2-thione (PubChem CID 21408915) has the molecular formula C15H9ClFNOS
and a molecular weight of 305.76 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-(4-fluorophenyl)-3H-1,3-oxazole-2-thione.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-5-(4-fluorophenyl)-3H-1,3-oxazole-2-thione |
| PubChem CID | 21408915 |
| Molecular Formula | C15H9ClFNOS |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 4-(4-chlorophenyl)-5-(4-fluorophenyl)-3H-1,3-oxazole-2-thione |
| SMILES | Fc1ccc(-c2oc(=S)[nH]c2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C15H9ClFNOS/c16-11-5-1-9(2-6-11)13-14(19-15(20)18-13)10-3-7-12(17)8-4-10/h1-8H,(H,18,20) |
| InChIKey | VVGFVAWNNHKQTD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-chlorophenyl)-5-(4-fluorophenyl)-3H-1,3-oxazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-5-(4-fluorophenyl)-3H-1,3-oxazole-2-thione?
The IUPAC name of 4-(4-chlorophenyl)-5-(4-fluorophenyl)-3H-1,3-oxazole-2-thione (CID 21408915) is 4-(4-chlorophenyl)-5-(4-fluorophenyl)-3H-1,3-oxazole-2-thione.
What is the SMILES notation for 4-(4-chlorophenyl)-5-(4-fluorophenyl)-3H-1,3-oxazole-2-thione?
The canonical SMILES for 4-(4-chlorophenyl)-5-(4-fluorophenyl)-3H-1,3-oxazole-2-thione is Fc1ccc(-c2oc(=S)[nH]c2-c2ccc(Cl)cc2)cc1.
What is the InChIKey of 4-(4-chlorophenyl)-5-(4-fluorophenyl)-3H-1,3-oxazole-2-thione?
The InChIKey is VVGFVAWNNHKQTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9ClFNOS/c16-11-5-1-9(2-6-11)13-14(19-15(20)18-13)10-3-7-12(17)8-4-10/h1-8H,(H,18,20).
What are the key properties of 4-(4-chlorophenyl)-5-(4-fluorophenyl)-3H-1,3-oxazole-2-thione?
4-(4-chlorophenyl)-5-(4-fluorophenyl)-3H-1,3-oxazole-2-thione has a molecular weight of 305.76 g/mol, XLogP of 5.46, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-5-(4-fluorophenyl)-3H-1,3-oxazole-2-thione is sourced from PubChem (CID 21408915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).