C19H18ClNO3S — CID 21409014
2-chlorobicyclo[2.2.0]hexa-1(4),2,5-triene;4-(4-methylphenyl)-1,3-oxazole;2-sulfanylpropanoic acid (PubChem CID 21409014) has the molecular formula C19H18ClNO3S and a molecular weight of 375.88 g/mol. Its IUPAC name is 2-chlorobicyclo[2.2.0]hexa-1(4),2,5-triene;4-(4-methylphenyl)-1,3-oxazole;2-sulfanylpropanoic acid.
| Compound Name | 2-chlorobicyclo[2.2.0]hexa-1(4),2,5-triene;4-(4-methylphenyl)-1,3-oxazole;2-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 21409014 |
| Molecular Formula | C19H18ClNO3S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 2-chlorobicyclo[2.2.0]hexa-1(4),2,5-triene;4-(4-methylphenyl)-1,3-oxazole;2-sulfanylpropanoic acid |
| SMILES | CC(S)C(=O)O.Cc1ccc(-c2cocn2)cc1.Clc1cc2ccc1=2 |
| InChI | InChI=1S/C10H9NO.C6H3Cl.C3H6O2S/c1-8-2-4-9(5-3-8)10-6-12-7-11-10;7-6-3-4-1-2-5(4)6;1-2(6)3(4)5/h2-7H,1H3;1-3H;2,6H,1H3,(H,4,5) |
| InChIKey | GGBFCVLCBOWPOD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|