About 5-(3,4-dimethoxyphenyl)-4-phenyl-1,3-oxazole;2-sulfanylpropanoic acid
5-(3,4-dimethoxyphenyl)-4-phenyl-1,3-oxazole;2-sulfanylpropanoic acid (PubChem CID 21409057) has the molecular formula C20H21NO5S
and a molecular weight of 387.46 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-4-phenyl-1,3-oxazole;2-sulfanylpropanoic acid.
Molecular Properties
| Compound Name | 5-(3,4-dimethoxyphenyl)-4-phenyl-1,3-oxazole;2-sulfanylpropanoic acid |
| PubChem CID | 21409057 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-4-phenyl-1,3-oxazole;2-sulfanylpropanoic acid |
| SMILES | CC(S)C(=O)O.COc1ccc(-c2ocnc2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C17H15NO3.C3H6O2S/c1-19-14-9-8-13(10-15(14)20-2)17-16(18-11-21-17)12-6-4-3-5-7-12;1-2(6)3(4)5/h3-11H,1-2H3;2,6H,1H3,(H,4,5) |
| InChIKey | CBPAYLQBEUGPPU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,4-dimethoxyphenyl)-4-phenyl-1,3-oxazole;2-sulfanylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dimethoxyphenyl)-4-phenyl-1,3-oxazole;2-sulfanylpropanoic acid?
The IUPAC name of 5-(3,4-dimethoxyphenyl)-4-phenyl-1,3-oxazole;2-sulfanylpropanoic acid (CID 21409057) is 5-(3,4-dimethoxyphenyl)-4-phenyl-1,3-oxazole;2-sulfanylpropanoic acid.
What is the SMILES notation for 5-(3,4-dimethoxyphenyl)-4-phenyl-1,3-oxazole;2-sulfanylpropanoic acid?
The canonical SMILES for 5-(3,4-dimethoxyphenyl)-4-phenyl-1,3-oxazole;2-sulfanylpropanoic acid is CC(S)C(=O)O.COc1ccc(-c2ocnc2-c2ccccc2)cc1OC.
What is the InChIKey of 5-(3,4-dimethoxyphenyl)-4-phenyl-1,3-oxazole;2-sulfanylpropanoic acid?
The InChIKey is CBPAYLQBEUGPPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO3.C3H6O2S/c1-19-14-9-8-13(10-15(14)20-2)17-16(18-11-21-17)12-6-4-3-5-7-12;1-2(6)3(4)5/h3-11H,1-2H3;2,6H,1H3,(H,4,5).
What are the key properties of 5-(3,4-dimethoxyphenyl)-4-phenyl-1,3-oxazole;2-sulfanylpropanoic acid?
5-(3,4-dimethoxyphenyl)-4-phenyl-1,3-oxazole;2-sulfanylpropanoic acid has a molecular weight of 387.46 g/mol, XLogP of 4.42, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethoxyphenyl)-4-phenyl-1,3-oxazole;2-sulfanylpropanoic acid is sourced from PubChem (CID 21409057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).