About 5,6-dimethoxy-N,N-dimethyl-1H-indazol-3-amine
5,6-dimethoxy-N,N-dimethyl-1H-indazol-3-amine (PubChem CID 21409226) has the molecular formula C11H15N3O2
and a molecular weight of 221.26 g/mol. Its IUPAC name is 5,6-dimethoxy-N,N-dimethyl-1H-indazol-3-amine.
Molecular Properties
| Compound Name | 5,6-dimethoxy-N,N-dimethyl-1H-indazol-3-amine |
| PubChem CID | 21409226 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 5,6-dimethoxy-N,N-dimethyl-1H-indazol-3-amine |
| SMILES | COc1cc2[nH]nc(N(C)C)c2cc1OC |
| InChI | InChI=1S/C11H15N3O2/c1-14(2)11-7-5-9(15-3)10(16-4)6-8(7)12-13-11/h5-6H,1-4H3,(H,12,13) |
| InChIKey | UTXGYTMBQPPYJA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-dimethoxy-N,N-dimethyl-1H-indazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethoxy-N,N-dimethyl-1H-indazol-3-amine?
The IUPAC name of 5,6-dimethoxy-N,N-dimethyl-1H-indazol-3-amine (CID 21409226) is 5,6-dimethoxy-N,N-dimethyl-1H-indazol-3-amine.
What is the SMILES notation for 5,6-dimethoxy-N,N-dimethyl-1H-indazol-3-amine?
The canonical SMILES for 5,6-dimethoxy-N,N-dimethyl-1H-indazol-3-amine is COc1cc2[nH]nc(N(C)C)c2cc1OC.
What is the InChIKey of 5,6-dimethoxy-N,N-dimethyl-1H-indazol-3-amine?
The InChIKey is UTXGYTMBQPPYJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O2/c1-14(2)11-7-5-9(15-3)10(16-4)6-8(7)12-13-11/h5-6H,1-4H3,(H,12,13).
What are the key properties of 5,6-dimethoxy-N,N-dimethyl-1H-indazol-3-amine?
5,6-dimethoxy-N,N-dimethyl-1H-indazol-3-amine has a molecular weight of 221.26 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethoxy-N,N-dimethyl-1H-indazol-3-amine is sourced from PubChem (CID 21409226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).