About 2-[2-[(3-methyl-1,2-thiazol-4-yl)methylsulfanyl]ethyl]guanidine
2-[2-[(3-methyl-1,2-thiazol-4-yl)methylsulfanyl]ethyl]guanidine (PubChem CID 21410033) has the molecular formula C8H14N4S2
and a molecular weight of 230.36 g/mol. Its IUPAC name is 2-[2-[(3-methyl-1,2-thiazol-4-yl)methylsulfanyl]ethyl]guanidine.
Molecular Properties
| Compound Name | 2-[2-[(3-methyl-1,2-thiazol-4-yl)methylsulfanyl]ethyl]guanidine |
| PubChem CID | 21410033 |
| Molecular Formula | C8H14N4S2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-[2-[(3-methyl-1,2-thiazol-4-yl)methylsulfanyl]ethyl]guanidine |
| SMILES | Cc1nscc1CSCCN=C(N)N |
| InChI | InChI=1S/C8H14N4S2/c1-6-7(5-14-12-6)4-13-3-2-11-8(9)10/h5H,2-4H2,1H3,(H4,9,10,11) |
| InChIKey | FOONSLWZDFKRJU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(3-methyl-1,2-thiazol-4-yl)methylsulfanyl]ethyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(3-methyl-1,2-thiazol-4-yl)methylsulfanyl]ethyl]guanidine?
The IUPAC name of 2-[2-[(3-methyl-1,2-thiazol-4-yl)methylsulfanyl]ethyl]guanidine (CID 21410033) is 2-[2-[(3-methyl-1,2-thiazol-4-yl)methylsulfanyl]ethyl]guanidine.
What is the SMILES notation for 2-[2-[(3-methyl-1,2-thiazol-4-yl)methylsulfanyl]ethyl]guanidine?
The canonical SMILES for 2-[2-[(3-methyl-1,2-thiazol-4-yl)methylsulfanyl]ethyl]guanidine is Cc1nscc1CSCCN=C(N)N.
What is the InChIKey of 2-[2-[(3-methyl-1,2-thiazol-4-yl)methylsulfanyl]ethyl]guanidine?
The InChIKey is FOONSLWZDFKRJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4S2/c1-6-7(5-14-12-6)4-13-3-2-11-8(9)10/h5H,2-4H2,1H3,(H4,9,10,11).
What are the key properties of 2-[2-[(3-methyl-1,2-thiazol-4-yl)methylsulfanyl]ethyl]guanidine?
2-[2-[(3-methyl-1,2-thiazol-4-yl)methylsulfanyl]ethyl]guanidine has a molecular weight of 230.36 g/mol, XLogP of 0.96, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(3-methyl-1,2-thiazol-4-yl)methylsulfanyl]ethyl]guanidine is sourced from PubChem (CID 21410033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).