C14H29ClN2O — CID 21410982
1-(3-chloro-2,4,4-trimethyl-1,3-oxazinan-2-yl)-N,N-diethylpropan-1-amine (PubChem CID 21410982) has the molecular formula C14H29ClN2O and a molecular weight of 276.85 g/mol. Its IUPAC name is 1-(3-chloro-2,4,4-trimethyl-1,3-oxazinan-2-yl)-N,N-diethylpropan-1-amine.
| Compound Name | 1-(3-chloro-2,4,4-trimethyl-1,3-oxazinan-2-yl)-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 21410982 |
| Molecular Formula | C14H29ClN2O |
| Molecular Weight | 276.85 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 1-(3-chloro-2,4,4-trimethyl-1,3-oxazinan-2-yl)-N,N-diethylpropan-1-amine |
| SMILES | CCC(N(CC)CC)C1(C)OCCC(C)(C)N1Cl |
| InChI | InChI=1S/C14H29ClN2O/c1-7-12(16(8-2)9-3)14(6)17(15)13(4,5)10-11-18-14/h12H,7-11H2,1-6H3 |
| InChIKey | ZXYHFBFMFZLLSC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.85 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|