C20H25F2NO — CID 21411078
1-(butylamino)-4,4-bis(4-fluorophenyl)butan-2-ol (PubChem CID 21411078) has the molecular formula C20H25F2NO and a molecular weight of 333.42 g/mol. Its IUPAC name is 1-(butylamino)-4,4-bis(4-fluorophenyl)butan-2-ol.
| Compound Name | 1-(butylamino)-4,4-bis(4-fluorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 21411078 |
| Molecular Formula | C20H25F2NO |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 1-(butylamino)-4,4-bis(4-fluorophenyl)butan-2-ol |
| SMILES | CCCCNCC(O)CC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H25F2NO/c1-2-3-12-23-14-19(24)13-20(15-4-8-17(21)9-5-15)16-6-10-18(22)11-7-16/h4-11,19-20,23-24H,2-3,12-14H2,1H3 |
| InChIKey | RYVBKDCVRFXBRN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|