About 2-(1-fluorohexyl)oxirane;oxetane
2-(1-fluorohexyl)oxirane;oxetane (PubChem CID 21411185) has the molecular formula C11H21FO2
and a molecular weight of 204.28 g/mol. Its IUPAC name is 2-(1-fluorohexyl)oxirane;oxetane.
Molecular Properties
| Compound Name | 2-(1-fluorohexyl)oxirane;oxetane |
| PubChem CID | 21411185 |
| Molecular Formula | C11H21FO2 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 2-(1-fluorohexyl)oxirane;oxetane |
| SMILES | C1COC1.CCCCCC(F)C1CO1 |
| InChI | InChI=1S/C8H15FO.C3H6O/c1-2-3-4-5-7(9)8-6-10-8;1-2-4-3-1/h7-8H,2-6H2,1H3;1-3H2 |
| InChIKey | YLUAROKNBUUYRT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-fluorohexyl)oxirane;oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-fluorohexyl)oxirane;oxetane?
The IUPAC name of 2-(1-fluorohexyl)oxirane;oxetane (CID 21411185) is 2-(1-fluorohexyl)oxirane;oxetane.
What is the SMILES notation for 2-(1-fluorohexyl)oxirane;oxetane?
The canonical SMILES for 2-(1-fluorohexyl)oxirane;oxetane is C1COC1.CCCCCC(F)C1CO1.
What is the InChIKey of 2-(1-fluorohexyl)oxirane;oxetane?
The InChIKey is YLUAROKNBUUYRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15FO.C3H6O/c1-2-3-4-5-7(9)8-6-10-8;1-2-4-3-1/h7-8H,2-6H2,1H3;1-3H2.
What are the key properties of 2-(1-fluorohexyl)oxirane;oxetane?
2-(1-fluorohexyl)oxirane;oxetane has a molecular weight of 204.28 g/mol, XLogP of 2.71, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-fluorohexyl)oxirane;oxetane is sourced from PubChem (CID 21411185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).