C12H23N2O7P — CID 21411657
[1,2-diethoxy-1-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)ethyl]phosphonic acid (PubChem CID 21411657) has the molecular formula C12H23N2O7P and a molecular weight of 338.30 g/mol. Its IUPAC name is [1,2-diethoxy-1-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)ethyl]phosphonic acid.
| Compound Name | [1,2-diethoxy-1-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)ethyl]phosphonic acid |
|---|---|
| PubChem CID | 21411657 |
| Molecular Formula | C12H23N2O7P |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | [1,2-diethoxy-1-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)ethyl]phosphonic acid |
| SMILES | CCOCC(OCC)(N1C(=O)NC(C)(CC)C1=O)P(=O)(O)O |
| InChI | InChI=1S/C12H23N2O7P/c1-5-11(4)9(15)14(10(16)13-11)12(21-7-3,8-20-6-2)22(17,18)19/h5-8H2,1-4H3,(H,13,16)(H2,17,18,19) |
| InChIKey | XBLDURCTOYGAPN-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|