C16H16ClNO4 — CID 21411664
4-(2-chlorophenyl)-1,2,6-trimethyl-4H-pyridine-3,5-dicarboxylic acid (PubChem CID 21411664) has the molecular formula C16H16ClNO4 and a molecular weight of 321.76 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-1,2,6-trimethyl-4H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 4-(2-chlorophenyl)-1,2,6-trimethyl-4H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 21411664 |
| Molecular Formula | C16H16ClNO4 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 4-(2-chlorophenyl)-1,2,6-trimethyl-4H-pyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2ccccc2Cl)C(C(=O)O)=C(C)N1C |
| InChI | InChI=1S/C16H16ClNO4/c1-8-12(15(19)20)14(10-6-4-5-7-11(10)17)13(16(21)22)9(2)18(8)3/h4-7,14H,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | STKDTEXAFQDQQA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |