C22H21NO4 — CID 21411673
1-benzyl-2,6-dimethyl-4-phenyl-4H-pyridine-3,5-dicarboxylic acid (PubChem CID 21411673) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is 1-benzyl-2,6-dimethyl-4-phenyl-4H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 1-benzyl-2,6-dimethyl-4-phenyl-4H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 21411673 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 1-benzyl-2,6-dimethyl-4-phenyl-4H-pyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2ccccc2)C(C(=O)O)=C(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H21NO4/c1-14-18(21(24)25)20(17-11-7-4-8-12-17)19(22(26)27)15(2)23(14)13-16-9-5-3-6-10-16/h3-12,20H,13H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | MGALQIASSJXQQG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |