About 4-hept-6-enyltetradecane-1,3-diamine
4-hept-6-enyltetradecane-1,3-diamine (PubChem CID 21411817) has the molecular formula C21H44N2
and a molecular weight of 324.60 g/mol. Its IUPAC name is 4-hept-6-enyltetradecane-1,3-diamine.
Molecular Properties
| Compound Name | 4-hept-6-enyltetradecane-1,3-diamine |
| PubChem CID | 21411817 |
| Molecular Formula | C21H44N2 |
| Molecular Weight | 324.60 g/mol |
| Exact Mass | 324.35 |
| IUPAC Name | 4-hept-6-enyltetradecane-1,3-diamine |
| SMILES | C=CCCCCCC(CCCCCCCCCC)C(N)CCN |
| InChI | InChI=1S/C21H44N2/c1-3-5-7-9-10-11-13-15-17-20(21(23)18-19-22)16-14-12-8-6-4-2/h4,20-21H,2-3,5-19,22-23H2,1H3 |
| InChIKey | TZJVVEYIIKULKX-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.60 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-hept-6-enyltetradecane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hept-6-enyltetradecane-1,3-diamine?
The IUPAC name of 4-hept-6-enyltetradecane-1,3-diamine (CID 21411817) is 4-hept-6-enyltetradecane-1,3-diamine.
What is the SMILES notation for 4-hept-6-enyltetradecane-1,3-diamine?
The canonical SMILES for 4-hept-6-enyltetradecane-1,3-diamine is C=CCCCCCC(CCCCCCCCCC)C(N)CCN.
What is the InChIKey of 4-hept-6-enyltetradecane-1,3-diamine?
The InChIKey is TZJVVEYIIKULKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44N2/c1-3-5-7-9-10-11-13-15-17-20(21(23)18-19-22)16-14-12-8-6-4-2/h4,20-21H,2-3,5-19,22-23H2,1H3.
What are the key properties of 4-hept-6-enyltetradecane-1,3-diamine?
4-hept-6-enyltetradecane-1,3-diamine has a molecular weight of 324.60 g/mol, XLogP of 5.95, 18 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hept-6-enyltetradecane-1,3-diamine is sourced from PubChem (CID 21411817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).