C13H17Cl — CID 21412770
1-(chloromethyl)-4-ethenyl-2,3,5,6-tetramethylbenzene (PubChem CID 21412770) has the molecular formula C13H17Cl and a molecular weight of 208.73 g/mol. Its IUPAC name is 1-(chloromethyl)-4-ethenyl-2,3,5,6-tetramethylbenzene.
| Compound Name | 1-(chloromethyl)-4-ethenyl-2,3,5,6-tetramethylbenzene |
|---|---|
| PubChem CID | 21412770 |
| Molecular Formula | C13H17Cl |
| Molecular Weight | 208.73 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1-(chloromethyl)-4-ethenyl-2,3,5,6-tetramethylbenzene |
| SMILES | C=Cc1c(C)c(C)c(CCl)c(C)c1C |
| InChI | InChI=1S/C13H17Cl/c1-6-12-8(2)10(4)13(7-14)11(5)9(12)3/h6H,1,7H2,2-5H3 |
| InChIKey | ZFQHTCWXXMPSPD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.73 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|