About 3-bromoquinoline
3-bromoquinoline (PubChem CID 21413) has the molecular formula C9H6BrN
and a molecular weight of 208.06 g/mol. Its IUPAC name is 3-bromoquinoline.
Molecular Properties
| Compound Name | 3-bromoquinoline |
| PubChem CID | 21413 |
| Molecular Formula | C9H6BrN |
| Molecular Weight | 208.06 g/mol |
| Exact Mass | 206.97 |
| IUPAC Name | 3-bromoquinoline |
| SMILES | Brc1cnc2ccccc2c1 |
| InChI | InChI=1S/C9H6BrN/c10-8-5-7-3-1-2-4-9(7)11-6-8/h1-6H |
| InChIKey | ZGIKWINFUGEQEO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.06 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromoquinoline?
The IUPAC name of 3-bromoquinoline (CID 21413) is 3-bromoquinoline.
What is the SMILES notation for 3-bromoquinoline?
The canonical SMILES for 3-bromoquinoline is Brc1cnc2ccccc2c1.
What is the InChIKey of 3-bromoquinoline?
The InChIKey is ZGIKWINFUGEQEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrN/c10-8-5-7-3-1-2-4-9(7)11-6-8/h1-6H.
What are the key properties of 3-bromoquinoline?
3-bromoquinoline has a molecular weight of 208.06 g/mol, XLogP of 3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromoquinoline is sourced from PubChem (CID 21413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).