About 1-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylhydrazine;hydrochloride
1-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylhydrazine;hydrochloride (PubChem CID 21413051) has the molecular formula C9H12ClN3S
and a molecular weight of 229.74 g/mol. Its IUPAC name is 1-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylhydrazine;hydrochloride.
Molecular Properties
| Compound Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylhydrazine;hydrochloride |
| PubChem CID | 21413051 |
| Molecular Formula | C9H12ClN3S |
| Molecular Weight | 229.74 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylhydrazine;hydrochloride |
| SMILES | Cl.c1ccc(NNC2=NCCS2)cc1 |
| InChI | InChI=1S/C9H11N3S.ClH/c1-2-4-8(5-3-1)11-12-9-10-6-7-13-9;/h1-5,11H,6-7H2,(H,10,12);1H |
| InChIKey | WIDXOYJUIIXHOP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.74 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylhydrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylhydrazine;hydrochloride?
The IUPAC name of 1-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylhydrazine;hydrochloride (CID 21413051) is 1-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylhydrazine;hydrochloride.
What is the SMILES notation for 1-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylhydrazine;hydrochloride?
The canonical SMILES for 1-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylhydrazine;hydrochloride is Cl.c1ccc(NNC2=NCCS2)cc1.
What is the InChIKey of 1-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylhydrazine;hydrochloride?
The InChIKey is WIDXOYJUIIXHOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3S.ClH/c1-2-4-8(5-3-1)11-12-9-10-6-7-13-9;/h1-5,11H,6-7H2,(H,10,12);1H.
What are the key properties of 1-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylhydrazine;hydrochloride?
1-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylhydrazine;hydrochloride has a molecular weight of 229.74 g/mol, XLogP of 2.13, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylhydrazine;hydrochloride is sourced from PubChem (CID 21413051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).