C9H12ClN3S — CID 21413051
1-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylhydrazine;hydrochloride (PubChem CID 21413051) has the molecular formula C9H12ClN3S and a molecular weight of 229.74 g/mol. Its IUPAC name is 1-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylhydrazine;hydrochloride.
| Compound Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylhydrazine;hydrochloride |
|---|---|
| PubChem CID | 21413051 |
| Molecular Formula | C9H12ClN3S |
| Molecular Weight | 229.74 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylhydrazine;hydrochloride |
| SMILES | Cl.c1ccc(NNC2=NCCS2)cc1 |
| InChI | InChI=1S/C9H11N3S.ClH/c1-2-4-8(5-3-1)11-12-9-10-6-7-13-9;/h1-5,11H,6-7H2,(H,10,12);1H |
| InChIKey | WIDXOYJUIIXHOP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.74 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|