About 1-(6-hydroxy-1,3-benzothiazol-2-yl)-3-phenylurea
1-(6-hydroxy-1,3-benzothiazol-2-yl)-3-phenylurea (PubChem CID 21413325) has the molecular formula C14H11N3O2S
and a molecular weight of 285.33 g/mol. Its IUPAC name is 1-(6-hydroxy-1,3-benzothiazol-2-yl)-3-phenylurea.
Molecular Properties
| Compound Name | 1-(6-hydroxy-1,3-benzothiazol-2-yl)-3-phenylurea |
| PubChem CID | 21413325 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 1-(6-hydroxy-1,3-benzothiazol-2-yl)-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1nc2ccc(O)cc2s1 |
| InChI | InChI=1S/C14H11N3O2S/c18-10-6-7-11-12(8-10)20-14(16-11)17-13(19)15-9-4-2-1-3-5-9/h1-8,18H,(H2,15,16,17,19) |
| InChIKey | FHGHSZMOPRZRNU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(6-hydroxy-1,3-benzothiazol-2-yl)-3-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-hydroxy-1,3-benzothiazol-2-yl)-3-phenylurea?
The IUPAC name of 1-(6-hydroxy-1,3-benzothiazol-2-yl)-3-phenylurea (CID 21413325) is 1-(6-hydroxy-1,3-benzothiazol-2-yl)-3-phenylurea.
What is the SMILES notation for 1-(6-hydroxy-1,3-benzothiazol-2-yl)-3-phenylurea?
The canonical SMILES for 1-(6-hydroxy-1,3-benzothiazol-2-yl)-3-phenylurea is O=C(Nc1ccccc1)Nc1nc2ccc(O)cc2s1.
What is the InChIKey of 1-(6-hydroxy-1,3-benzothiazol-2-yl)-3-phenylurea?
The InChIKey is FHGHSZMOPRZRNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O2S/c18-10-6-7-11-12(8-10)20-14(16-11)17-13(19)15-9-4-2-1-3-5-9/h1-8,18H,(H2,15,16,17,19).
What are the key properties of 1-(6-hydroxy-1,3-benzothiazol-2-yl)-3-phenylurea?
1-(6-hydroxy-1,3-benzothiazol-2-yl)-3-phenylurea has a molecular weight of 285.33 g/mol, XLogP of 3.65, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-hydroxy-1,3-benzothiazol-2-yl)-3-phenylurea is sourced from PubChem (CID 21413325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).