About N-carbamimidoyl-N-(2,6-dichlorophenyl)acetamide
N-carbamimidoyl-N-(2,6-dichlorophenyl)acetamide (PubChem CID 21413966) has the molecular formula C9H9Cl2N3O
and a molecular weight of 246.10 g/mol. Its IUPAC name is N-carbamimidoyl-N-(2,6-dichlorophenyl)acetamide.
Molecular Properties
| Compound Name | N-carbamimidoyl-N-(2,6-dichlorophenyl)acetamide |
| PubChem CID | 21413966 |
| Molecular Formula | C9H9Cl2N3O |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | N-carbamimidoyl-N-(2,6-dichlorophenyl)acetamide |
| SMILES | [H]/N=C(\N)N(C(C)=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H9Cl2N3O/c1-5(15)14(9(12)13)8-6(10)3-2-4-7(8)11/h2-4H,1H3,(H3,12,13) |
| InChIKey | KFGNMPMBYUYTMN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-carbamimidoyl-N-(2,6-dichlorophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-carbamimidoyl-N-(2,6-dichlorophenyl)acetamide?
The IUPAC name of N-carbamimidoyl-N-(2,6-dichlorophenyl)acetamide (CID 21413966) is N-carbamimidoyl-N-(2,6-dichlorophenyl)acetamide.
What is the SMILES notation for N-carbamimidoyl-N-(2,6-dichlorophenyl)acetamide?
The canonical SMILES for N-carbamimidoyl-N-(2,6-dichlorophenyl)acetamide is [H]/N=C(\N)N(C(C)=O)c1c(Cl)cccc1Cl.
What is the InChIKey of N-carbamimidoyl-N-(2,6-dichlorophenyl)acetamide?
The InChIKey is KFGNMPMBYUYTMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl2N3O/c1-5(15)14(9(12)13)8-6(10)3-2-4-7(8)11/h2-4H,1H3,(H3,12,13).
What are the key properties of N-carbamimidoyl-N-(2,6-dichlorophenyl)acetamide?
N-carbamimidoyl-N-(2,6-dichlorophenyl)acetamide has a molecular weight of 246.10 g/mol, XLogP of 2.24, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-carbamimidoyl-N-(2,6-dichlorophenyl)acetamide is sourced from PubChem (CID 21413966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).