C24H12F42N3O6P3 — CID 21414155
1,2,2,4,5,6-hexakis(2,2,3,3,4,4,4-heptafluorobutoxy)-1,3,5-triaza-2λ5,4,6-triphosphacyclohex-2-ene (PubChem CID 21414155) has the molecular formula C24H12F42N3O6P3 and a molecular weight of 1329.21 g/mol. Its IUPAC name is 1,2,2,4,5,6-hexakis(2,2,3,3,4,4,4-heptafluorobutoxy)-1,3,5-triaza-2λ5,4,6-triphosphacyclohex-2-ene.
| Compound Name | 1,2,2,4,5,6-hexakis(2,2,3,3,4,4,4-heptafluorobutoxy)-1,3,5-triaza-2λ5,4,6-triphosphacyclohex-2-ene |
|---|---|
| PubChem CID | 21414155 |
| Molecular Formula | C24H12F42N3O6P3 |
| Molecular Weight | 1329.21 g/mol |
| Exact Mass | 1328.93 |
| IUPAC Name | 1,2,2,4,5,6-hexakis(2,2,3,3,4,4,4-heptafluorobutoxy)-1,3,5-triaza-2λ5,4,6-triphosphacyclohex-2-ene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)CON1P(OCC(F)(F)C(F)(F)C(F)(F)F)N=P(OCC(F)(F)C(F)(F)C(F)(F)F)(OCC(F)(F)C(F)(F)C(F)(F)F)N(OCC(F)(F)C(F)(F)C(F)(F)F)P1OCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H12F42N3O6P3/c25-7(26,13(37,38)19(49,50)51)1-70-68-76(72-3-9(29,30)15(41,42)21(55,56)57)67-78(74-5-11(33,34)17(45,46)23(61,62)63,75-6-12(35,36)18(47,48)24(64,65)66)69(71-2-8(27,28)14(39,40)20(52,53)54)77(68)73-4-10(31,32)16(43,44)22(58,59)60/h1-6H2 |
| InChIKey | OKTJTDHTEBENFF-UHFFFAOYSA-N |
| XLogP | 15.93 |
| TPSA | 74.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1329.21 |
| LogP ≤ 5 | 15.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|