C16H13NO — CID 21414236
N-(11-tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaenylidene)hydroxylamine (PubChem CID 21414236) has the molecular formula C16H13NO and a molecular weight of 235.29 g/mol. Its IUPAC name is N-(11-tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaenylidene)hydroxylamine.
| Compound Name | N-(11-tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaenylidene)hydroxylamine |
|---|---|
| PubChem CID | 21414236 |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | N-(11-tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaenylidene)hydroxylamine |
| SMILES | ON=C1c2ccccc2C2CC2c2ccccc21 |
| InChI | InChI=1S/C16H13NO/c18-17-16-12-7-3-1-5-10(12)14-9-15(14)11-6-2-4-8-13(11)16/h1-8,14-15,18H,9H2 |
| InChIKey | NOPRIQWDIMTGOH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|