C19H20N2 — CID 21414244
N-methyl-2-(11-tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaenylideneamino)ethanamine (PubChem CID 21414244) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N-methyl-2-(11-tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaenylideneamino)ethanamine.
| Compound Name | N-methyl-2-(11-tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaenylideneamino)ethanamine |
|---|---|
| PubChem CID | 21414244 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-methyl-2-(11-tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaenylideneamino)ethanamine |
| SMILES | CNCCN=C1c2ccccc2C2CC2c2ccccc21 |
| InChI | InChI=1S/C19H20N2/c1-20-10-11-21-19-15-8-4-2-6-13(15)17-12-18(17)14-7-3-5-9-16(14)19/h2-9,17-18,20H,10-12H2,1H3 |
| InChIKey | HFTQXFBRFZPMFQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|