C20H23N3O2 — CID 21414275
N-butyl-2-oxo-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepine-4-carboxamide (PubChem CID 21414275) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-butyl-2-oxo-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepine-4-carboxamide.
| Compound Name | N-butyl-2-oxo-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepine-4-carboxamide |
|---|---|
| PubChem CID | 21414275 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-butyl-2-oxo-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepine-4-carboxamide |
| SMILES | CCCCNC(=O)N1CC(=O)Nc2ccccc2C1c1ccccc1 |
| InChI | InChI=1S/C20H23N3O2/c1-2-3-13-21-20(25)23-14-18(24)22-17-12-8-7-11-16(17)19(23)15-9-5-4-6-10-15/h4-12,19H,2-3,13-14H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | CPJLFEPKUPGAOX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|