About [N'-(2-morpholin-4-ylethyl)carbamimidoyl]urea
[N'-(2-morpholin-4-ylethyl)carbamimidoyl]urea (PubChem CID 21414777) has the molecular formula C8H17N5O2
and a molecular weight of 215.26 g/mol. Its IUPAC name is [N'-(2-morpholin-4-ylethyl)carbamimidoyl]urea.
Molecular Properties
| Compound Name | [N'-(2-morpholin-4-ylethyl)carbamimidoyl]urea |
| PubChem CID | 21414777 |
| Molecular Formula | C8H17N5O2 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | [N'-(2-morpholin-4-ylethyl)carbamimidoyl]urea |
| SMILES | NC(=O)N/C(N)=N/CCN1CCOCC1 |
| InChI | InChI=1S/C8H17N5O2/c9-7(12-8(10)14)11-1-2-13-3-5-15-6-4-13/h1-6H2,(H5,9,10,11,12,14) |
| InChIKey | BCRZKAOKIVAIKL-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [N'-(2-morpholin-4-ylethyl)carbamimidoyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [N'-(2-morpholin-4-ylethyl)carbamimidoyl]urea?
The IUPAC name of [N'-(2-morpholin-4-ylethyl)carbamimidoyl]urea (CID 21414777) is [N'-(2-morpholin-4-ylethyl)carbamimidoyl]urea.
What is the SMILES notation for [N'-(2-morpholin-4-ylethyl)carbamimidoyl]urea?
The canonical SMILES for [N'-(2-morpholin-4-ylethyl)carbamimidoyl]urea is NC(=O)N/C(N)=N/CCN1CCOCC1.
What is the InChIKey of [N'-(2-morpholin-4-ylethyl)carbamimidoyl]urea?
The InChIKey is BCRZKAOKIVAIKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N5O2/c9-7(12-8(10)14)11-1-2-13-3-5-15-6-4-13/h1-6H2,(H5,9,10,11,12,14).
What are the key properties of [N'-(2-morpholin-4-ylethyl)carbamimidoyl]urea?
[N'-(2-morpholin-4-ylethyl)carbamimidoyl]urea has a molecular weight of 215.26 g/mol, XLogP of -1.70, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [N'-(2-morpholin-4-ylethyl)carbamimidoyl]urea is sourced from PubChem (CID 21414777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).