4-methylthiomorpholine-3-carboxylic acid

C6H11NO2S — CID 21414977

IUPAC4-methylthiomorpholine-3-carboxylic acid
SMILESCN1CCSCC1C(=O)O
InChIInChI=1S/C6H11NO2S/c1-7-2-3-10-4-5(7)6(8)9/h5H,2-4H2,1H3,(H,8,9)
InChIKeyZNYOZAXACXIHRT-UHFFFAOYSA-N
MW161.23 g/mol
LogP0.12
Rot. Bonds1

About 4-methylthiomorpholine-3-carboxylic acid

4-methylthiomorpholine-3-carboxylic acid (PubChem CID 21414977) has the molecular formula C6H11NO2S and a molecular weight of 161.23 g/mol. Its IUPAC name is 4-methylthiomorpholine-3-carboxylic acid.

Molecular Properties

Compound Name4-methylthiomorpholine-3-carboxylic acid
PubChem CID21414977
Molecular FormulaC6H11NO2S
Molecular Weight161.23 g/mol
Exact Mass161.05
IUPAC Name4-methylthiomorpholine-3-carboxylic acid
SMILESCN1CCSCC1C(=O)O
InChIInChI=1S/C6H11NO2S/c1-7-2-3-10-4-5(7)6(8)9/h5H,2-4H2,1H3,(H,8,9)
InChIKeyZNYOZAXACXIHRT-UHFFFAOYSA-N
XLogP0.12
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.23
LogP ≤ 50.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-methylthiomorpholine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methylthiomorpholine-3-carboxylic acid?
The IUPAC name of 4-methylthiomorpholine-3-carboxylic acid (CID 21414977) is 4-methylthiomorpholine-3-carboxylic acid.
What is the SMILES notation for 4-methylthiomorpholine-3-carboxylic acid?
The canonical SMILES for 4-methylthiomorpholine-3-carboxylic acid is CN1CCSCC1C(=O)O.
What is the InChIKey of 4-methylthiomorpholine-3-carboxylic acid?
The InChIKey is ZNYOZAXACXIHRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2S/c1-7-2-3-10-4-5(7)6(8)9/h5H,2-4H2,1H3,(H,8,9).
What are the key properties of 4-methylthiomorpholine-3-carboxylic acid?
4-methylthiomorpholine-3-carboxylic acid has a molecular weight of 161.23 g/mol, XLogP of 0.12, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylthiomorpholine-3-carboxylic acid is sourced from PubChem (CID 21414977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).