About butyl 2-propyl-1,3-thiazole-5-carboxylate
butyl 2-propyl-1,3-thiazole-5-carboxylate (PubChem CID 21415070) has the molecular formula C11H17NO2S
and a molecular weight of 227.33 g/mol. Its IUPAC name is butyl 2-propyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | butyl 2-propyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 21415070 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | butyl 2-propyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCOC(=O)c1cnc(CCC)s1 |
| InChI | InChI=1S/C11H17NO2S/c1-3-5-7-14-11(13)9-8-12-10(15-9)6-4-2/h8H,3-7H2,1-2H3 |
| InChIKey | SJBPAOJLISTUAJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-propyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-propyl-1,3-thiazole-5-carboxylate?
The IUPAC name of butyl 2-propyl-1,3-thiazole-5-carboxylate (CID 21415070) is butyl 2-propyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for butyl 2-propyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for butyl 2-propyl-1,3-thiazole-5-carboxylate is CCCCOC(=O)c1cnc(CCC)s1.
What is the InChIKey of butyl 2-propyl-1,3-thiazole-5-carboxylate?
The InChIKey is SJBPAOJLISTUAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2S/c1-3-5-7-14-11(13)9-8-12-10(15-9)6-4-2/h8H,3-7H2,1-2H3.
What are the key properties of butyl 2-propyl-1,3-thiazole-5-carboxylate?
butyl 2-propyl-1,3-thiazole-5-carboxylate has a molecular weight of 227.33 g/mol, XLogP of 3.05, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-propyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 21415070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).