About 1,3,5-triethyladamantane
1,3,5-triethyladamantane (PubChem CID 21415733) has the molecular formula C16H28
and a molecular weight of 220.40 g/mol. Its IUPAC name is 1,3,5-triethyladamantane.
Molecular Properties
| Compound Name | 1,3,5-triethyladamantane |
| PubChem CID | 21415733 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | 1,3,5-triethyladamantane |
| SMILES | CCC12CC3CC(CC)(C1)CC(CC)(C3)C2 |
| InChI | InChI=1S/C16H28/c1-4-14-7-13-8-15(5-2,10-14)12-16(6-3,9-13)11-14/h13H,4-12H2,1-3H3 |
| InChIKey | DNVVOGZRZMWYJG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3,5-triethyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-triethyladamantane?
The IUPAC name of 1,3,5-triethyladamantane (CID 21415733) is 1,3,5-triethyladamantane.
What is the SMILES notation for 1,3,5-triethyladamantane?
The canonical SMILES for 1,3,5-triethyladamantane is CCC12CC3CC(CC)(C1)CC(CC)(C3)C2.
What is the InChIKey of 1,3,5-triethyladamantane?
The InChIKey is DNVVOGZRZMWYJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28/c1-4-14-7-13-8-15(5-2,10-14)12-16(6-3,9-13)11-14/h13H,4-12H2,1-3H3.
What are the key properties of 1,3,5-triethyladamantane?
1,3,5-triethyladamantane has a molecular weight of 220.40 g/mol, XLogP of 5.17, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-triethyladamantane is sourced from PubChem (CID 21415733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).