About 1-(1,2-dimethyl-5-phenylpyrazol-2-ium-3-yl)-4-phenylpiperidine iodide
1-(1,2-dimethyl-5-phenylpyrazol-2-ium-3-yl)-4-phenylpiperidine iodide (PubChem CID 21416254) has the molecular formula C22H26IN3
and a molecular weight of 459.38 g/mol. Its IUPAC name is 1-(1,2-dimethyl-5-phenylpyrazol-2-ium-3-yl)-4-phenylpiperidine iodide.
Molecular Properties
| Compound Name | 1-(1,2-dimethyl-5-phenylpyrazol-2-ium-3-yl)-4-phenylpiperidine iodide |
| PubChem CID | 21416254 |
| Molecular Formula | C22H26IN3 |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 1-(1,2-dimethyl-5-phenylpyrazol-2-ium-3-yl)-4-phenylpiperidine iodide |
| SMILES | Cn1c(-c2ccccc2)cc(N2CCC(c3ccccc3)CC2)[n+]1C.[I-] |
| InChI | InChI=1S/C22H26N3.HI/c1-23-21(20-11-7-4-8-12-20)17-22(24(23)2)25-15-13-19(14-16-25)18-9-5-3-6-10-18;/h3-12,17,19H,13-16H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | PRSFUQXRSRNOCW-UHFFFAOYSA-M |
| XLogP | 0.90 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,2-dimethyl-5-phenylpyrazol-2-ium-3-yl)-4-phenylpiperidine iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-dimethyl-5-phenylpyrazol-2-ium-3-yl)-4-phenylpiperidine iodide?
The IUPAC name of 1-(1,2-dimethyl-5-phenylpyrazol-2-ium-3-yl)-4-phenylpiperidine iodide (CID 21416254) is 1-(1,2-dimethyl-5-phenylpyrazol-2-ium-3-yl)-4-phenylpiperidine iodide.
What is the SMILES notation for 1-(1,2-dimethyl-5-phenylpyrazol-2-ium-3-yl)-4-phenylpiperidine iodide?
The canonical SMILES for 1-(1,2-dimethyl-5-phenylpyrazol-2-ium-3-yl)-4-phenylpiperidine iodide is Cn1c(-c2ccccc2)cc(N2CCC(c3ccccc3)CC2)[n+]1C.[I-].
What is the InChIKey of 1-(1,2-dimethyl-5-phenylpyrazol-2-ium-3-yl)-4-phenylpiperidine iodide?
The InChIKey is PRSFUQXRSRNOCW-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H26N3.HI/c1-23-21(20-11-7-4-8-12-20)17-22(24(23)2)25-15-13-19(14-16-25)18-9-5-3-6-10-18;/h3-12,17,19H,13-16H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 1-(1,2-dimethyl-5-phenylpyrazol-2-ium-3-yl)-4-phenylpiperidine iodide?
1-(1,2-dimethyl-5-phenylpyrazol-2-ium-3-yl)-4-phenylpiperidine iodide has a molecular weight of 459.38 g/mol, XLogP of 0.90, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-dimethyl-5-phenylpyrazol-2-ium-3-yl)-4-phenylpiperidine iodide is sourced from PubChem (CID 21416254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).