C15H26BrN3O3S — CID 21416980
1-[4-(tert-butylsulfamoylamino)phenyl]-2-(cyclopropylamino)ethanol;hydrobromide (PubChem CID 21416980) has the molecular formula C15H26BrN3O3S and a molecular weight of 408.36 g/mol. Its IUPAC name is 1-[4-(tert-butylsulfamoylamino)phenyl]-2-(cyclopropylamino)ethanol;hydrobromide.
| Compound Name | 1-[4-(tert-butylsulfamoylamino)phenyl]-2-(cyclopropylamino)ethanol;hydrobromide |
|---|---|
| PubChem CID | 21416980 |
| Molecular Formula | C15H26BrN3O3S |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 1-[4-(tert-butylsulfamoylamino)phenyl]-2-(cyclopropylamino)ethanol;hydrobromide |
| SMILES | Br.CC(C)(C)NS(=O)(=O)Nc1ccc(C(O)CNC2CC2)cc1 |
| InChI | InChI=1S/C15H25N3O3S.BrH/c1-15(2,3)18-22(20,21)17-13-6-4-11(5-7-13)14(19)10-16-12-8-9-12;/h4-7,12,14,16-19H,8-10H2,1-3H3;1H |
| InChIKey | MXXCDYFIPRDIEK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |