About (5-methyl-4,5-dihydro-1H-imidazol-2-yl)hydrazine;hydrochloride
(5-methyl-4,5-dihydro-1H-imidazol-2-yl)hydrazine;hydrochloride (PubChem CID 21417147) has the molecular formula C4H11ClN4
and a molecular weight of 150.61 g/mol. Its IUPAC name is (5-methyl-4,5-dihydro-1H-imidazol-2-yl)hydrazine;hydrochloride.
Molecular Properties
| Compound Name | (5-methyl-4,5-dihydro-1H-imidazol-2-yl)hydrazine;hydrochloride |
| PubChem CID | 21417147 |
| Molecular Formula | C4H11ClN4 |
| Molecular Weight | 150.61 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | (5-methyl-4,5-dihydro-1H-imidazol-2-yl)hydrazine;hydrochloride |
| SMILES | CC1CN=C(NN)N1.Cl |
| InChI | InChI=1S/C4H10N4.ClH/c1-3-2-6-4(7-3)8-5;/h3H,2,5H2,1H3,(H2,6,7,8);1H |
| InChIKey | KJKCLOVUOIZSOA-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.61 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-4,5-dihydro-1H-imidazol-2-yl)hydrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-4,5-dihydro-1H-imidazol-2-yl)hydrazine;hydrochloride?
The IUPAC name of (5-methyl-4,5-dihydro-1H-imidazol-2-yl)hydrazine;hydrochloride (CID 21417147) is (5-methyl-4,5-dihydro-1H-imidazol-2-yl)hydrazine;hydrochloride.
What is the SMILES notation for (5-methyl-4,5-dihydro-1H-imidazol-2-yl)hydrazine;hydrochloride?
The canonical SMILES for (5-methyl-4,5-dihydro-1H-imidazol-2-yl)hydrazine;hydrochloride is CC1CN=C(NN)N1.Cl.
What is the InChIKey of (5-methyl-4,5-dihydro-1H-imidazol-2-yl)hydrazine;hydrochloride?
The InChIKey is KJKCLOVUOIZSOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N4.ClH/c1-3-2-6-4(7-3)8-5;/h3H,2,5H2,1H3,(H2,6,7,8);1H.
What are the key properties of (5-methyl-4,5-dihydro-1H-imidazol-2-yl)hydrazine;hydrochloride?
(5-methyl-4,5-dihydro-1H-imidazol-2-yl)hydrazine;hydrochloride has a molecular weight of 150.61 g/mol, XLogP of -0.78, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-4,5-dihydro-1H-imidazol-2-yl)hydrazine;hydrochloride is sourced from PubChem (CID 21417147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).