C14H14N4O2S — CID 21417190
2-tert-butyl-6-phenyl-[1,3,4]thiadiazolo[3,2-a][1,3,5]triazine-5,7-dione (PubChem CID 21417190) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 2-tert-butyl-6-phenyl-[1,3,4]thiadiazolo[3,2-a][1,3,5]triazine-5,7-dione.
| Compound Name | 2-tert-butyl-6-phenyl-[1,3,4]thiadiazolo[3,2-a][1,3,5]triazine-5,7-dione |
|---|---|
| PubChem CID | 21417190 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-tert-butyl-6-phenyl-[1,3,4]thiadiazolo[3,2-a][1,3,5]triazine-5,7-dione |
| SMILES | CC(C)(C)c1nn2c(=O)n(-c3ccccc3)c(=O)nc2s1 |
| InChI | InChI=1S/C14H14N4O2S/c1-14(2,3)10-16-18-12(21-10)15-11(19)17(13(18)20)9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | LGAAPSVWALTEDO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 69.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |