C21H18NO6+ — CID 21417676
8,9,17-trimethoxy-4,6-dioxa-13-azoniapentacyclo[11.8.0.02,10.03,7.015,20]henicosa-1(13),2(10),3(7),8,11,14,16,18,20-nonaen-16-ol (PubChem CID 21417676) has the molecular formula C21H18NO6+ and a molecular weight of 380.38 g/mol. Its IUPAC name is 8,9,17-trimethoxy-4,6-dioxa-13-azoniapentacyclo[11.8.0.02,10.03,7.015,20]henicosa-1(13),2(10),3(7),8,11,14,16,18,20-nonaen-16-ol.
| Compound Name | 8,9,17-trimethoxy-4,6-dioxa-13-azoniapentacyclo[11.8.0.02,10.03,7.015,20]henicosa-1(13),2(10),3(7),8,11,14,16,18,20-nonaen-16-ol |
|---|---|
| PubChem CID | 21417676 |
| Molecular Formula | C21H18NO6+ |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 8,9,17-trimethoxy-4,6-dioxa-13-azoniapentacyclo[11.8.0.02,10.03,7.015,20]henicosa-1(13),2(10),3(7),8,11,14,16,18,20-nonaen-16-ol |
| SMILES | COc1ccc2cc3c4c5c(c(OC)c(OC)c4cc[n+]3cc2c1O)OCO5 |
| InChI | InChI=1S/C21H17NO6/c1-24-15-5-4-11-8-14-16-12(6-7-22(14)9-13(11)17(15)23)18(25-2)20(26-3)21-19(16)27-10-28-21/h4-9H,10H2,1-3H3/p+1 |
| InChIKey | YFFVKXAUKKAZAK-UHFFFAOYSA-O |
| XLogP | 3.19 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|