C20H16BrNO3 — CID 21417704
14,21-dimethyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,11,14,16,18,20-nonaen-16-ol bromide (PubChem CID 21417704) has the molecular formula C20H16BrNO3 and a molecular weight of 398.26 g/mol. Its IUPAC name is 14,21-dimethyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,11,14,16,18,20-nonaen-16-ol bromide.
| Compound Name | 14,21-dimethyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,11,14,16,18,20-nonaen-16-ol bromide |
|---|---|
| PubChem CID | 21417704 |
| Molecular Formula | C20H16BrNO3 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 14,21-dimethyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,11,14,16,18,20-nonaen-16-ol bromide |
| SMILES | Cc1c2cccc(O)c2c(C)[n+]2ccc3cc4c(cc3c12)OCO4.[Br-] |
| InChI | InChI=1S/C20H15NO3.BrH/c1-11-14-4-3-5-16(22)19(14)12(2)21-7-6-13-8-17-18(24-10-23-17)9-15(13)20(11)21;/h3-9H,10H2,1-2H3;1H |
| InChIKey | XJZZMSUZYMUNQV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 42.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|