C24H12Cl4N2O5 — CID 21417787
2-(2,4-dichlorophenyl)-1-[2-(2,4-dichlorophenyl)-4-nitrophenoxy]-4-nitrobenzene (PubChem CID 21417787) has the molecular formula C24H12Cl4N2O5 and a molecular weight of 550.18 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-[2-(2,4-dichlorophenyl)-4-nitrophenoxy]-4-nitrobenzene.
| Compound Name | 2-(2,4-dichlorophenyl)-1-[2-(2,4-dichlorophenyl)-4-nitrophenoxy]-4-nitrobenzene |
|---|---|
| PubChem CID | 21417787 |
| Molecular Formula | C24H12Cl4N2O5 |
| Molecular Weight | 550.18 g/mol |
| Exact Mass | 547.95 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-[2-(2,4-dichlorophenyl)-4-nitrophenoxy]-4-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc([N+](=O)[O-])cc2-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C24H12Cl4N2O5/c25-13-1-5-17(21(27)9-13)19-11-15(29(31)32)3-7-23(19)35-24-8-4-16(30(33)34)12-20(24)18-6-2-14(26)10-22(18)28/h1-12H |
| InChIKey | ROUFUQPIBFZUGG-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.18 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|