About N-tert-butyl-2,2-dichloro-3,3-dimethylcyclopropane-1-carboxamide
N-tert-butyl-2,2-dichloro-3,3-dimethylcyclopropane-1-carboxamide (PubChem CID 21417880) has the molecular formula C10H17Cl2NO
and a molecular weight of 238.16 g/mol. Its IUPAC name is N-tert-butyl-2,2-dichloro-3,3-dimethylcyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | N-tert-butyl-2,2-dichloro-3,3-dimethylcyclopropane-1-carboxamide |
| PubChem CID | 21417880 |
| Molecular Formula | C10H17Cl2NO |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | N-tert-butyl-2,2-dichloro-3,3-dimethylcyclopropane-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1C(C)(C)C1(Cl)Cl |
| InChI | InChI=1S/C10H17Cl2NO/c1-8(2,3)13-7(14)6-9(4,5)10(6,11)12/h6H,1-5H3,(H,13,14) |
| InChIKey | SFGUOHLYRDZQLU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-2,2-dichloro-3,3-dimethylcyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2,2-dichloro-3,3-dimethylcyclopropane-1-carboxamide?
The IUPAC name of N-tert-butyl-2,2-dichloro-3,3-dimethylcyclopropane-1-carboxamide (CID 21417880) is N-tert-butyl-2,2-dichloro-3,3-dimethylcyclopropane-1-carboxamide.
What is the SMILES notation for N-tert-butyl-2,2-dichloro-3,3-dimethylcyclopropane-1-carboxamide?
The canonical SMILES for N-tert-butyl-2,2-dichloro-3,3-dimethylcyclopropane-1-carboxamide is CC(C)(C)NC(=O)C1C(C)(C)C1(Cl)Cl.
What is the InChIKey of N-tert-butyl-2,2-dichloro-3,3-dimethylcyclopropane-1-carboxamide?
The InChIKey is SFGUOHLYRDZQLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17Cl2NO/c1-8(2,3)13-7(14)6-9(4,5)10(6,11)12/h6H,1-5H3,(H,13,14).
What are the key properties of N-tert-butyl-2,2-dichloro-3,3-dimethylcyclopropane-1-carboxamide?
N-tert-butyl-2,2-dichloro-3,3-dimethylcyclopropane-1-carboxamide has a molecular weight of 238.16 g/mol, XLogP of 2.73, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2,2-dichloro-3,3-dimethylcyclopropane-1-carboxamide is sourced from PubChem (CID 21417880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).