About sodium 1-(2,3-dihydroxypropoxy)-5H-naphthalen-5-ide-2-sulfonic acid
sodium 1-(2,3-dihydroxypropoxy)-5H-naphthalen-5-ide-2-sulfonic acid (PubChem CID 21417905) has the molecular formula C13H13NaO6S
and a molecular weight of 320.30 g/mol. Its IUPAC name is sodium 1-(2,3-dihydroxypropoxy)-5H-naphthalen-5-ide-2-sulfonic acid.
Molecular Properties
| Compound Name | sodium 1-(2,3-dihydroxypropoxy)-5H-naphthalen-5-ide-2-sulfonic acid |
| PubChem CID | 21417905 |
| Molecular Formula | C13H13NaO6S |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | sodium 1-(2,3-dihydroxypropoxy)-5H-naphthalen-5-ide-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2[c-]cccc2c1OCC(O)CO.[Na+] |
| InChI | InChI=1S/C13H13O6S.Na/c14-7-10(15)8-19-13-11-4-2-1-3-9(11)5-6-12(13)20(16,17)18;/h1-2,4-6,10,14-15H,7-8H2,(H,16,17,18);/q-1;+1 |
| InChIKey | DFNADKBKRUVOFQ-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 1-(2,3-dihydroxypropoxy)-5H-naphthalen-5-ide-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1-(2,3-dihydroxypropoxy)-5H-naphthalen-5-ide-2-sulfonic acid?
The IUPAC name of sodium 1-(2,3-dihydroxypropoxy)-5H-naphthalen-5-ide-2-sulfonic acid (CID 21417905) is sodium 1-(2,3-dihydroxypropoxy)-5H-naphthalen-5-ide-2-sulfonic acid.
What is the SMILES notation for sodium 1-(2,3-dihydroxypropoxy)-5H-naphthalen-5-ide-2-sulfonic acid?
The canonical SMILES for sodium 1-(2,3-dihydroxypropoxy)-5H-naphthalen-5-ide-2-sulfonic acid is O=S(=O)(O)c1ccc2[c-]cccc2c1OCC(O)CO.[Na+].
What is the InChIKey of sodium 1-(2,3-dihydroxypropoxy)-5H-naphthalen-5-ide-2-sulfonic acid?
The InChIKey is DFNADKBKRUVOFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13O6S.Na/c14-7-10(15)8-19-13-11-4-2-1-3-9(11)5-6-12(13)20(16,17)18;/h1-2,4-6,10,14-15H,7-8H2,(H,16,17,18);/q-1;+1.
What are the key properties of sodium 1-(2,3-dihydroxypropoxy)-5H-naphthalen-5-ide-2-sulfonic acid?
sodium 1-(2,3-dihydroxypropoxy)-5H-naphthalen-5-ide-2-sulfonic acid has a molecular weight of 320.30 g/mol, XLogP of -2.38, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-(2,3-dihydroxypropoxy)-5H-naphthalen-5-ide-2-sulfonic acid is sourced from PubChem (CID 21417905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).