About 4-(7,7-diphenyl-1,4-oxazepan-4-yl)butanenitrile
4-(7,7-diphenyl-1,4-oxazepan-4-yl)butanenitrile (PubChem CID 21418258) has the molecular formula C21H24N2O
and a molecular weight of 320.44 g/mol. Its IUPAC name is 4-(7,7-diphenyl-1,4-oxazepan-4-yl)butanenitrile.
Molecular Properties
| Compound Name | 4-(7,7-diphenyl-1,4-oxazepan-4-yl)butanenitrile |
| PubChem CID | 21418258 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 4-(7,7-diphenyl-1,4-oxazepan-4-yl)butanenitrile |
| SMILES | N#CCCCN1CCOC(c2ccccc2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H24N2O/c22-14-7-8-15-23-16-13-21(24-18-17-23,19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-6,9-12H,7-8,13,15-18H2 |
| InChIKey | DEHYQKBUWCZXBM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(7,7-diphenyl-1,4-oxazepan-4-yl)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7,7-diphenyl-1,4-oxazepan-4-yl)butanenitrile?
The IUPAC name of 4-(7,7-diphenyl-1,4-oxazepan-4-yl)butanenitrile (CID 21418258) is 4-(7,7-diphenyl-1,4-oxazepan-4-yl)butanenitrile.
What is the SMILES notation for 4-(7,7-diphenyl-1,4-oxazepan-4-yl)butanenitrile?
The canonical SMILES for 4-(7,7-diphenyl-1,4-oxazepan-4-yl)butanenitrile is N#CCCCN1CCOC(c2ccccc2)(c2ccccc2)CC1.
What is the InChIKey of 4-(7,7-diphenyl-1,4-oxazepan-4-yl)butanenitrile?
The InChIKey is DEHYQKBUWCZXBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O/c22-14-7-8-15-23-16-13-21(24-18-17-23,19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-6,9-12H,7-8,13,15-18H2.
What are the key properties of 4-(7,7-diphenyl-1,4-oxazepan-4-yl)butanenitrile?
4-(7,7-diphenyl-1,4-oxazepan-4-yl)butanenitrile has a molecular weight of 320.44 g/mol, XLogP of 3.96, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7,7-diphenyl-1,4-oxazepan-4-yl)butanenitrile is sourced from PubChem (CID 21418258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).