C14H12F17NO2S — CID 21418863
N-cyclohexyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide (PubChem CID 21418863) has the molecular formula C14H12F17NO2S and a molecular weight of 581.29 g/mol. Its IUPAC name is N-cyclohexyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide.
| Compound Name | N-cyclohexyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide |
|---|---|
| PubChem CID | 21418863 |
| Molecular Formula | C14H12F17NO2S |
| Molecular Weight | 581.29 g/mol |
| Exact Mass | 581.03 |
| IUPAC Name | N-cyclohexyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide |
| SMILES | O=S(=O)(NC1CCCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F17NO2S/c15-7(16,9(19,20)11(23,24)13(27,28)29)8(17,18)10(21,22)12(25,26)14(30,31)35(33,34)32-6-4-2-1-3-5-6/h6,32H,1-5H2 |
| InChIKey | BHWRQVNQTHLHJB-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.29 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|