C11H15NO — CID 21419181
1,2-dimethyl-4,5-dihydro-1H-3,2-benzoxazepine (PubChem CID 21419181) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 1,2-dimethyl-4,5-dihydro-1H-3,2-benzoxazepine.
| Compound Name | 1,2-dimethyl-4,5-dihydro-1H-3,2-benzoxazepine |
|---|---|
| PubChem CID | 21419181 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 1,2-dimethyl-4,5-dihydro-1H-3,2-benzoxazepine |
| SMILES | CC1c2ccccc2CCON1C |
| InChI | InChI=1S/C11H15NO/c1-9-11-6-4-3-5-10(11)7-8-13-12(9)2/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | ITBCTGWCJNNRRE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |