About 4,5-dihydro-1H-3,2-benzoxazepine-2-carbonyl chloride
4,5-dihydro-1H-3,2-benzoxazepine-2-carbonyl chloride (PubChem CID 21419182) has the molecular formula C10H10ClNO2
and a molecular weight of 211.65 g/mol. Its IUPAC name is 4,5-dihydro-1H-3,2-benzoxazepine-2-carbonyl chloride.
Molecular Properties
| Compound Name | 4,5-dihydro-1H-3,2-benzoxazepine-2-carbonyl chloride |
| PubChem CID | 21419182 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 4,5-dihydro-1H-3,2-benzoxazepine-2-carbonyl chloride |
| SMILES | O=C(Cl)N1Cc2ccccc2CCO1 |
| InChI | InChI=1S/C10H10ClNO2/c11-10(13)12-7-9-4-2-1-3-8(9)5-6-14-12/h1-4H,5-7H2 |
| InChIKey | JEBRDMNOXQFSAZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydro-1H-3,2-benzoxazepine-2-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1H-3,2-benzoxazepine-2-carbonyl chloride?
The IUPAC name of 4,5-dihydro-1H-3,2-benzoxazepine-2-carbonyl chloride (CID 21419182) is 4,5-dihydro-1H-3,2-benzoxazepine-2-carbonyl chloride.
What is the SMILES notation for 4,5-dihydro-1H-3,2-benzoxazepine-2-carbonyl chloride?
The canonical SMILES for 4,5-dihydro-1H-3,2-benzoxazepine-2-carbonyl chloride is O=C(Cl)N1Cc2ccccc2CCO1.
What is the InChIKey of 4,5-dihydro-1H-3,2-benzoxazepine-2-carbonyl chloride?
The InChIKey is JEBRDMNOXQFSAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClNO2/c11-10(13)12-7-9-4-2-1-3-8(9)5-6-14-12/h1-4H,5-7H2.
What are the key properties of 4,5-dihydro-1H-3,2-benzoxazepine-2-carbonyl chloride?
4,5-dihydro-1H-3,2-benzoxazepine-2-carbonyl chloride has a molecular weight of 211.65 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1H-3,2-benzoxazepine-2-carbonyl chloride is sourced from PubChem (CID 21419182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).