About 2-butyl-1-methyl-4,5-dihydro-1H-3,2-benzoxazepine
2-butyl-1-methyl-4,5-dihydro-1H-3,2-benzoxazepine (PubChem CID 21419184) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-butyl-1-methyl-4,5-dihydro-1H-3,2-benzoxazepine.
Molecular Properties
| Compound Name | 2-butyl-1-methyl-4,5-dihydro-1H-3,2-benzoxazepine |
| PubChem CID | 21419184 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 2-butyl-1-methyl-4,5-dihydro-1H-3,2-benzoxazepine |
| SMILES | CCCCN1OCCc2ccccc2C1C |
| InChI | InChI=1S/C14H21NO/c1-3-4-10-15-12(2)14-8-6-5-7-13(14)9-11-16-15/h5-8,12H,3-4,9-11H2,1-2H3 |
| InChIKey | XEZNPFCJHAQZRP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-1-methyl-4,5-dihydro-1H-3,2-benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1-methyl-4,5-dihydro-1H-3,2-benzoxazepine?
The IUPAC name of 2-butyl-1-methyl-4,5-dihydro-1H-3,2-benzoxazepine (CID 21419184) is 2-butyl-1-methyl-4,5-dihydro-1H-3,2-benzoxazepine.
What is the SMILES notation for 2-butyl-1-methyl-4,5-dihydro-1H-3,2-benzoxazepine?
The canonical SMILES for 2-butyl-1-methyl-4,5-dihydro-1H-3,2-benzoxazepine is CCCCN1OCCc2ccccc2C1C.
What is the InChIKey of 2-butyl-1-methyl-4,5-dihydro-1H-3,2-benzoxazepine?
The InChIKey is XEZNPFCJHAQZRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO/c1-3-4-10-15-12(2)14-8-6-5-7-13(14)9-11-16-15/h5-8,12H,3-4,9-11H2,1-2H3.
What are the key properties of 2-butyl-1-methyl-4,5-dihydro-1H-3,2-benzoxazepine?
2-butyl-1-methyl-4,5-dihydro-1H-3,2-benzoxazepine has a molecular weight of 219.33 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1-methyl-4,5-dihydro-1H-3,2-benzoxazepine is sourced from PubChem (CID 21419184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).