C9H11NO — CID 21419189
1,2,4,5-tetrahydro-3,2-benzoxazepine (PubChem CID 21419189) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 1,2,4,5-tetrahydro-3,2-benzoxazepine.
| Compound Name | 1,2,4,5-tetrahydro-3,2-benzoxazepine |
|---|---|
| PubChem CID | 21419189 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 1,2,4,5-tetrahydro-3,2-benzoxazepine |
| SMILES | c1ccc2c(c1)CCONC2 |
| InChI | InChI=1S/C9H11NO/c1-2-4-9-7-10-11-6-5-8(9)3-1/h1-4,10H,5-7H2 |
| InChIKey | JSWFONBGIQJDMD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |