About piperazine;1-piperazin-1-ylethanone
piperazine;1-piperazin-1-ylethanone (PubChem CID 21419671) has the molecular formula C10H22N4O
and a molecular weight of 214.31 g/mol. Its IUPAC name is piperazine;1-piperazin-1-ylethanone.
Molecular Properties
| Compound Name | piperazine;1-piperazin-1-ylethanone |
| PubChem CID | 21419671 |
| Molecular Formula | C10H22N4O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | piperazine;1-piperazin-1-ylethanone |
| SMILES | C1CNCCN1.CC(=O)N1CCNCC1 |
| InChI | InChI=1S/C6H12N2O.C4H10N2/c1-6(9)8-4-2-7-3-5-8;1-2-6-4-3-5-1/h7H,2-5H2,1H3;5-6H,1-4H2 |
| InChIKey | JYZXQTSZJAUBRJ-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperazine;1-piperazin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine;1-piperazin-1-ylethanone?
The IUPAC name of piperazine;1-piperazin-1-ylethanone (CID 21419671) is piperazine;1-piperazin-1-ylethanone.
What is the SMILES notation for piperazine;1-piperazin-1-ylethanone?
The canonical SMILES for piperazine;1-piperazin-1-ylethanone is C1CNCCN1.CC(=O)N1CCNCC1.
What is the InChIKey of piperazine;1-piperazin-1-ylethanone?
The InChIKey is JYZXQTSZJAUBRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.C4H10N2/c1-6(9)8-4-2-7-3-5-8;1-2-6-4-3-5-1/h7H,2-5H2,1H3;5-6H,1-4H2.
What are the key properties of piperazine;1-piperazin-1-ylethanone?
piperazine;1-piperazin-1-ylethanone has a molecular weight of 214.31 g/mol, XLogP of -1.38, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine;1-piperazin-1-ylethanone is sourced from PubChem (CID 21419671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).