About N-(1-chloroethyl)-N',N'-dimethylethane-1,2-diamine
N-(1-chloroethyl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 21419871) has the molecular formula C6H15ClN2
and a molecular weight of 150.65 g/mol. Its IUPAC name is N-(1-chloroethyl)-N',N'-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(1-chloroethyl)-N',N'-dimethylethane-1,2-diamine |
| PubChem CID | 21419871 |
| Molecular Formula | C6H15ClN2 |
| Molecular Weight | 150.65 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | N-(1-chloroethyl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | CC(Cl)NCCN(C)C |
| InChI | InChI=1S/C6H15ClN2/c1-6(7)8-4-5-9(2)3/h6,8H,4-5H2,1-3H3 |
| InChIKey | XFKWVVBAQHUYCX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.65 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(1-chloroethyl)-N',N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-chloroethyl)-N',N'-dimethylethane-1,2-diamine?
The IUPAC name of N-(1-chloroethyl)-N',N'-dimethylethane-1,2-diamine (CID 21419871) is N-(1-chloroethyl)-N',N'-dimethylethane-1,2-diamine.
What is the SMILES notation for N-(1-chloroethyl)-N',N'-dimethylethane-1,2-diamine?
The canonical SMILES for N-(1-chloroethyl)-N',N'-dimethylethane-1,2-diamine is CC(Cl)NCCN(C)C.
What is the InChIKey of N-(1-chloroethyl)-N',N'-dimethylethane-1,2-diamine?
The InChIKey is XFKWVVBAQHUYCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15ClN2/c1-6(7)8-4-5-9(2)3/h6,8H,4-5H2,1-3H3.
What are the key properties of N-(1-chloroethyl)-N',N'-dimethylethane-1,2-diamine?
N-(1-chloroethyl)-N',N'-dimethylethane-1,2-diamine has a molecular weight of 150.65 g/mol, XLogP of 0.72, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-chloroethyl)-N',N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 21419871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).