About N-[2,2-bis(benzenesulfonyl)ethenyl]-4-methylaniline
N-[2,2-bis(benzenesulfonyl)ethenyl]-4-methylaniline (PubChem CID 2142011) has the molecular formula C21H19NO4S2
and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[2,2-bis(benzenesulfonyl)ethenyl]-4-methylaniline.
Molecular Properties
| Compound Name | N-[2,2-bis(benzenesulfonyl)ethenyl]-4-methylaniline |
| PubChem CID | 2142011 |
| Molecular Formula | C21H19NO4S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | N-[2,2-bis(benzenesulfonyl)ethenyl]-4-methylaniline |
| SMILES | Cc1ccc(NC=C(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H19NO4S2/c1-17-12-14-18(15-13-17)22-16-21(27(23,24)19-8-4-2-5-9-19)28(25,26)20-10-6-3-7-11-20/h2-16,22H,1H3 |
| InChIKey | POQNVPRKCYTURP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2,2-bis(benzenesulfonyl)ethenyl]-4-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,2-bis(benzenesulfonyl)ethenyl]-4-methylaniline?
The IUPAC name of N-[2,2-bis(benzenesulfonyl)ethenyl]-4-methylaniline (CID 2142011) is N-[2,2-bis(benzenesulfonyl)ethenyl]-4-methylaniline.
What is the SMILES notation for N-[2,2-bis(benzenesulfonyl)ethenyl]-4-methylaniline?
The canonical SMILES for N-[2,2-bis(benzenesulfonyl)ethenyl]-4-methylaniline is Cc1ccc(NC=C(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)cc1.
What is the InChIKey of N-[2,2-bis(benzenesulfonyl)ethenyl]-4-methylaniline?
The InChIKey is POQNVPRKCYTURP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19NO4S2/c1-17-12-14-18(15-13-17)22-16-21(27(23,24)19-8-4-2-5-9-19)28(25,26)20-10-6-3-7-11-20/h2-16,22H,1H3.
What are the key properties of N-[2,2-bis(benzenesulfonyl)ethenyl]-4-methylaniline?
N-[2,2-bis(benzenesulfonyl)ethenyl]-4-methylaniline has a molecular weight of 413.52 g/mol, XLogP of 4.15, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,2-bis(benzenesulfonyl)ethenyl]-4-methylaniline is sourced from PubChem (CID 2142011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).