About 1-(N-ethylanilino)ethyl [4-(2,4,4-trimethylpentan-2-yl)phenyl] carbonate
1-(N-ethylanilino)ethyl [4-(2,4,4-trimethylpentan-2-yl)phenyl] carbonate (PubChem CID 21420364) has the molecular formula C25H35NO3
and a molecular weight of 397.56 g/mol. Its IUPAC name is 1-(N-ethylanilino)ethyl [4-(2,4,4-trimethylpentan-2-yl)phenyl] carbonate.
Molecular Properties
| Compound Name | 1-(N-ethylanilino)ethyl [4-(2,4,4-trimethylpentan-2-yl)phenyl] carbonate |
| PubChem CID | 21420364 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 1-(N-ethylanilino)ethyl [4-(2,4,4-trimethylpentan-2-yl)phenyl] carbonate |
| SMILES | CCN(c1ccccc1)C(C)OC(=O)Oc1ccc(C(C)(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H35NO3/c1-8-26(21-12-10-9-11-13-21)19(2)28-23(27)29-22-16-14-20(15-17-22)25(6,7)18-24(3,4)5/h9-17,19H,8,18H2,1-7H3 |
| InChIKey | ROPPHHRBHJSDQC-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 1-(N-ethylanilino)ethyl [4-(2,4,4-trimethylpentan-2-yl)phenyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(N-ethylanilino)ethyl [4-(2,4,4-trimethylpentan-2-yl)phenyl] carbonate?
The IUPAC name of 1-(N-ethylanilino)ethyl [4-(2,4,4-trimethylpentan-2-yl)phenyl] carbonate (CID 21420364) is 1-(N-ethylanilino)ethyl [4-(2,4,4-trimethylpentan-2-yl)phenyl] carbonate.
What is the SMILES notation for 1-(N-ethylanilino)ethyl [4-(2,4,4-trimethylpentan-2-yl)phenyl] carbonate?
The canonical SMILES for 1-(N-ethylanilino)ethyl [4-(2,4,4-trimethylpentan-2-yl)phenyl] carbonate is CCN(c1ccccc1)C(C)OC(=O)Oc1ccc(C(C)(C)CC(C)(C)C)cc1.
What is the InChIKey of 1-(N-ethylanilino)ethyl [4-(2,4,4-trimethylpentan-2-yl)phenyl] carbonate?
The InChIKey is ROPPHHRBHJSDQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H35NO3/c1-8-26(21-12-10-9-11-13-21)19(2)28-23(27)29-22-16-14-20(15-17-22)25(6,7)18-24(3,4)5/h9-17,19H,8,18H2,1-7H3.
What are the key properties of 1-(N-ethylanilino)ethyl [4-(2,4,4-trimethylpentan-2-yl)phenyl] carbonate?
1-(N-ethylanilino)ethyl [4-(2,4,4-trimethylpentan-2-yl)phenyl] carbonate has a molecular weight of 397.56 g/mol, XLogP of 6.79, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(N-ethylanilino)ethyl [4-(2,4,4-trimethylpentan-2-yl)phenyl] carbonate is sourced from PubChem (CID 21420364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).