C17H16N2O2 — CID 21420491
4-amino-9-methyl-13-oxa-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-3-one (PubChem CID 21420491) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 4-amino-9-methyl-13-oxa-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-3-one.
| Compound Name | 4-amino-9-methyl-13-oxa-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-3-one |
|---|---|
| PubChem CID | 21420491 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-amino-9-methyl-13-oxa-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-3-one |
| SMILES | Cc1ccc2c(c1)C1CC(N)C(=O)N1c1ccccc1O2 |
| InChI | InChI=1S/C17H16N2O2/c1-10-6-7-15-11(8-10)14-9-12(18)17(20)19(14)13-4-2-3-5-16(13)21-15/h2-8,12,14H,9,18H2,1H3 |
| InChIKey | LKSOIHZUFODRRC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |