C17H18N2O — CID 21420496
9-methyl-13-oxa-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-amine (PubChem CID 21420496) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 9-methyl-13-oxa-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-amine.
| Compound Name | 9-methyl-13-oxa-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-amine |
|---|---|
| PubChem CID | 21420496 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 9-methyl-13-oxa-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-amine |
| SMILES | Cc1ccc2c(c1)C1CC(N)CN1c1ccccc1O2 |
| InChI | InChI=1S/C17H18N2O/c1-11-6-7-16-13(8-11)15-9-12(18)10-19(15)14-4-2-3-5-17(14)20-16/h2-8,12,15H,9-10,18H2,1H3 |
| InChIKey | PMQMGGZCQIIUJD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |