C19H18N2O2 — CID 21420506
N-(9-methyl-3-oxo-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)formamide (PubChem CID 21420506) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is N-(9-methyl-3-oxo-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)formamide.
| Compound Name | N-(9-methyl-3-oxo-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)formamide |
|---|---|
| PubChem CID | 21420506 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-(9-methyl-3-oxo-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)formamide |
| SMILES | Cc1ccc2c(c1)C1CC(NC=O)C(=O)N1c1ccccc1C2 |
| InChI | InChI=1S/C19H18N2O2/c1-12-6-7-13-9-14-4-2-3-5-17(14)21-18(15(13)8-12)10-16(19(21)23)20-11-22/h2-8,11,16,18H,9-10H2,1H3,(H,20,22) |
| InChIKey | IJYIJYWWTBXRIO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|